C17H14N2O3 — CID 110682649
5-methyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-carboxamide (PubChem CID 110682649) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-methyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110682649 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-methyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C17H14N2O3/c1-12-14(11-18-22-12)17(20)19-15-9-5-6-10-16(15)21-13-7-3-2-4-8-13/h2-11H,1H3,(H,19,20) |
| InChIKey | SYFGQGUCDOIVJK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |