C23H19N3O3 — CID 2813151
1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-(2-phenoxyphenyl)urea (PubChem CID 2813151) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-(2-phenoxyphenyl)urea.
| Compound Name | 1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-(2-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 2813151 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-(2-phenoxyphenyl)urea |
| SMILES | Cc1onc(-c2ccccc2)c1NC(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c1-16-21(22(26-29-16)17-10-4-2-5-11-17)25-23(27)24-19-14-8-9-15-20(19)28-18-12-6-3-7-13-18/h2-15H,1H3,(H2,24,25,27) |
| InChIKey | RXFCCSHOKZOXFL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |