C21H18N4O3 — CID 2764630
1,3-bis(5-methyl-3-phenyl-1,2-oxazol-4-yl)urea (PubChem CID 2764630) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1,3-bis(5-methyl-3-phenyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1,3-bis(5-methyl-3-phenyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 2764630 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1,3-bis(5-methyl-3-phenyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1onc(-c2ccccc2)c1NC(=O)Nc1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C21H18N4O3/c1-13-17(19(24-27-13)15-9-5-3-6-10-15)22-21(26)23-18-14(2)28-25-20(18)16-11-7-4-8-12-16/h3-12H,1-2H3,(H2,22,23,26) |
| InChIKey | UXNRZRDQHDHVAN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |