C13H11NO3 — CID 170872194
(E)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)prop-2-enoic acid (PubChem CID 170872194) has the molecular formula C13H11NO3 and a molecular weight of 229.24 g/mol. Its IUPAC name is (E)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 170872194 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (E)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)prop-2-enoic acid |
| SMILES | Cc1onc(-c2ccccc2)c1/C=C/C(=O)O |
| InChI | InChI=1S/C13H11NO3/c1-9-11(7-8-12(15)16)13(14-17-9)10-5-3-2-4-6-10/h2-8H,1H3,(H,15,16)/b8-7+ |
| InChIKey | UJNKDWCGGAEASV-BQYQJAHWSA-N |
| XLogP | 2.75 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|