C22H22N2O2S — CID 171353123
N-[[4-[(E)-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)ethenyl]phenyl]methyl]-2-sulfanylpropanamide (PubChem CID 171353123) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[[4-[(E)-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)ethenyl]phenyl]methyl]-2-sulfanylpropanamide.
| Compound Name | N-[[4-[(E)-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)ethenyl]phenyl]methyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 171353123 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[[4-[(E)-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)ethenyl]phenyl]methyl]-2-sulfanylpropanamide |
| SMILES | Cc1onc(-c2ccccc2)c1/C=C/c1ccc(CNC(=O)C(C)S)cc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-15-20(21(24-26-15)19-6-4-3-5-7-19)13-12-17-8-10-18(11-9-17)14-23-22(25)16(2)27/h3-13,16,27H,14H2,1-2H3,(H,23,25)/b13-12+ |
| InChIKey | DGOYOCWNRBRVGP-OUKQBFOZSA-N |
| XLogP | 4.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|