C12H8Br2ClNO2 — CID 64721323
[5-chloro-6-(2,4-dibromophenoxy)-3-pyridinyl]methanol (PubChem CID 64721323) has the molecular formula C12H8Br2ClNO2 and a molecular weight of 393.46 g/mol. Its IUPAC name is [5-chloro-6-(2,4-dibromophenoxy)-3-pyridinyl]methanol.
| Compound Name | [5-chloro-6-(2,4-dibromophenoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 64721323 |
| Molecular Formula | C12H8Br2ClNO2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 390.86 |
| IUPAC Name | [5-chloro-6-(2,4-dibromophenoxy)-3-pyridinyl]methanol |
| SMILES | OCc1cnc(Oc2ccc(Br)cc2Br)c(Cl)c1 |
| InChI | InChI=1S/C12H8Br2ClNO2/c13-8-1-2-11(9(14)4-8)18-12-10(15)3-7(6-17)5-16-12/h1-5,17H,6H2 |
| InChIKey | WPTBTJODTHJFAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |