C14H13BrCl2N2O — CID 62321679
N-[[6-(4-bromo-2-chlorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine (PubChem CID 62321679) has the molecular formula C14H13BrCl2N2O and a molecular weight of 376.08 g/mol. Its IUPAC name is N-[[6-(4-bromo-2-chlorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[6-(4-bromo-2-chlorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62321679 |
| Molecular Formula | C14H13BrCl2N2O |
| Molecular Weight | 376.08 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | N-[[6-(4-bromo-2-chlorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cnc(Oc2ccc(Br)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13BrCl2N2O/c1-2-18-7-9-5-12(17)14(19-8-9)20-13-4-3-10(15)6-11(13)16/h3-6,8,18H,2,7H2,1H3 |
| InChIKey | SYBWJMIYFUBHKP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.08 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |