C14H12BrClF2N2O — CID 107101217
N-[[6-(5-bromo-2,3-difluorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine (PubChem CID 107101217) has the molecular formula C14H12BrClF2N2O and a molecular weight of 377.62 g/mol. Its IUPAC name is N-[[6-(5-bromo-2,3-difluorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[6-(5-bromo-2,3-difluorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 107101217 |
| Molecular Formula | C14H12BrClF2N2O |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | N-[[6-(5-bromo-2,3-difluorophenoxy)-5-chloro-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cnc(Oc2cc(Br)cc(F)c2F)c(Cl)c1 |
| InChI | InChI=1S/C14H12BrClF2N2O/c1-2-19-6-8-3-10(16)14(20-7-8)21-12-5-9(15)4-11(17)13(12)18/h3-5,7,19H,2,6H2,1H3 |
| InChIKey | UIXXERWJFDTGSO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|