C9H13BrN2O — CID 163278698
N-[(5-bromo-6-methoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 163278698) has the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. Its IUPAC name is N-[(5-bromo-6-methoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-6-methoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 163278698 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | N-[(5-bromo-6-methoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | CCNCc1cnc(OC)c(Br)c1 |
| InChI | InChI=1S/C9H13BrN2O/c1-3-11-5-7-4-8(10)9(13-2)12-6-7/h4,6,11H,3,5H2,1-2H3 |
| InChIKey | HAKKTCWBEXSTOT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |