C15H16ClNO2 — CID 61256314
[5-chloro-6-(2,3,5-trimethylphenoxy)-3-pyridinyl]methanol (PubChem CID 61256314) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is [5-chloro-6-(2,3,5-trimethylphenoxy)-3-pyridinyl]methanol.
| Compound Name | [5-chloro-6-(2,3,5-trimethylphenoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 61256314 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | [5-chloro-6-(2,3,5-trimethylphenoxy)-3-pyridinyl]methanol |
| SMILES | Cc1cc(C)c(C)c(Oc2ncc(CO)cc2Cl)c1 |
| InChI | InChI=1S/C15H16ClNO2/c1-9-4-10(2)11(3)14(5-9)19-15-13(16)6-12(8-18)7-17-15/h4-7,18H,8H2,1-3H3 |
| InChIKey | ZZQJFGKLLJQPLK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |