C10H5Br2ClN2O — CID 64719536
2-chloro-3-(2,4-dibromophenoxy)pyrazine (PubChem CID 64719536) has the molecular formula C10H5Br2ClN2O and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-chloro-3-(2,4-dibromophenoxy)pyrazine.
| Compound Name | 2-chloro-3-(2,4-dibromophenoxy)pyrazine |
|---|---|
| PubChem CID | 64719536 |
| Molecular Formula | C10H5Br2ClN2O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 361.85 |
| IUPAC Name | 2-chloro-3-(2,4-dibromophenoxy)pyrazine |
| SMILES | Clc1nccnc1Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H5Br2ClN2O/c11-6-1-2-8(7(12)5-6)16-10-9(13)14-3-4-15-10/h1-5H |
| InChIKey | VWJPLSLYMQGXOA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |