C9H5Br2NO2 — CID 68870605
2-(2,4-dibromophenoxy)-1,3-oxazole (PubChem CID 68870605) has the molecular formula C9H5Br2NO2 and a molecular weight of 318.95 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-1,3-oxazole.
| Compound Name | 2-(2,4-dibromophenoxy)-1,3-oxazole |
|---|---|
| PubChem CID | 68870605 |
| Molecular Formula | C9H5Br2NO2 |
| Molecular Weight | 318.95 g/mol |
| Exact Mass | 316.87 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-1,3-oxazole |
| SMILES | Brc1ccc(Oc2ncco2)c(Br)c1 |
| InChI | InChI=1S/C9H5Br2NO2/c10-6-1-2-8(7(11)5-6)14-9-12-3-4-13-9/h1-5H |
| InChIKey | CPJXZIOKKXRKEC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.95 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |