C12H9Br3N2O — CID 64721342
[5-bromo-2-(2,4-dibromophenoxy)-3-pyridinyl]methanamine (PubChem CID 64721342) has the molecular formula C12H9Br3N2O and a molecular weight of 436.93 g/mol. Its IUPAC name is [5-bromo-2-(2,4-dibromophenoxy)-3-pyridinyl]methanamine.
| Compound Name | [5-bromo-2-(2,4-dibromophenoxy)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 64721342 |
| Molecular Formula | C12H9Br3N2O |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 433.83 |
| IUPAC Name | [5-bromo-2-(2,4-dibromophenoxy)-3-pyridinyl]methanamine |
| SMILES | NCc1cc(Br)cnc1Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H9Br3N2O/c13-8-1-2-11(10(15)4-8)18-12-7(5-16)3-9(14)6-17-12/h1-4,6H,5,16H2 |
| InChIKey | UTOGFSBVMWVJBY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |