C10H5Br2IN2O — CID 66319605
4-(2,4-dibromophenoxy)-5-iodopyrimidine (PubChem CID 66319605) has the molecular formula C10H5Br2IN2O and a molecular weight of 455.88 g/mol. Its IUPAC name is 4-(2,4-dibromophenoxy)-5-iodopyrimidine.
| Compound Name | 4-(2,4-dibromophenoxy)-5-iodopyrimidine |
|---|---|
| PubChem CID | 66319605 |
| Molecular Formula | C10H5Br2IN2O |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 453.78 |
| IUPAC Name | 4-(2,4-dibromophenoxy)-5-iodopyrimidine |
| SMILES | Brc1ccc(Oc2ncncc2I)c(Br)c1 |
| InChI | InChI=1S/C10H5Br2IN2O/c11-6-1-2-9(7(12)3-6)16-10-8(13)4-14-5-15-10/h1-5H |
| InChIKey | NQKPDIGKTDZMOU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|