C7H6IN5O — CID 106597704
5-iodo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidine (PubChem CID 106597704) has the molecular formula C7H6IN5O and a molecular weight of 303.06 g/mol. Its IUPAC name is 5-iodo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidine.
| Compound Name | 5-iodo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidine |
|---|---|
| PubChem CID | 106597704 |
| Molecular Formula | C7H6IN5O |
| Molecular Weight | 303.06 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 5-iodo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidine |
| SMILES | Cn1cnc(Oc2ncncc2I)n1 |
| InChI | InChI=1S/C7H6IN5O/c1-13-4-11-7(12-13)14-6-5(8)2-9-3-10-6/h2-4H,1H3 |
| InChIKey | AQMBKGIGELGZDP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.06 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|