C11H7Br2N3OS — CID 107548659
2-(2,4-dibromophenoxy)pyrimidine-4-carbothioamide (PubChem CID 107548659) has the molecular formula C11H7Br2N3OS and a molecular weight of 389.07 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)pyrimidine-4-carbothioamide.
| Compound Name | 2-(2,4-dibromophenoxy)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548659 |
| Molecular Formula | C11H7Br2N3OS |
| Molecular Weight | 389.07 g/mol |
| Exact Mass | 386.87 |
| IUPAC Name | 2-(2,4-dibromophenoxy)pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Oc2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C11H7Br2N3OS/c12-6-1-2-9(7(13)5-6)17-11-15-4-3-8(16-11)10(14)18/h1-5H,(H2,14,18) |
| InChIKey | QDDSUGIECYFIJJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.07 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|