C11H6Cl3N3OS — CID 107548379
2-(2,4,5-trichlorophenoxy)pyrimidine-4-carbothioamide (PubChem CID 107548379) has the molecular formula C11H6Cl3N3OS and a molecular weight of 334.62 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenoxy)pyrimidine-4-carbothioamide.
| Compound Name | 2-(2,4,5-trichlorophenoxy)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548379 |
| Molecular Formula | C11H6Cl3N3OS |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | 2-(2,4,5-trichlorophenoxy)pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Oc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H6Cl3N3OS/c12-5-3-7(14)9(4-6(5)13)18-11-16-2-1-8(17-11)10(15)19/h1-4H,(H2,15,19) |
| InChIKey | DPKCZUAXBIZGTQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|