C15H19N5O — CID 80866417
4-(2,4-dimethylphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80866417) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(2,4-dimethylphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,4-dimethylphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80866417 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-(2,4-dimethylphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(Oc2nc(N)nc(N3CCCC3)n2)c(C)c1 |
| InChI | InChI=1S/C15H19N5O/c1-10-5-6-12(11(2)9-10)21-15-18-13(16)17-14(19-15)20-7-3-4-8-20/h5-6,9H,3-4,7-8H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | LNBMFMSWRUKFAN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |