C10H15N5O — CID 80867785
4-prop-2-enoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80867785) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-prop-2-enoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-prop-2-enoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80867785 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 4-prop-2-enoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | C=CCOc1nc(N)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C10H15N5O/c1-2-7-16-10-13-8(11)12-9(14-10)15-5-3-4-6-15/h2H,1,3-7H2,(H2,11,12,13,14) |
| InChIKey | QAQQYVWCOVSSDG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|