C19H25N7O3 — CID 27396221
4-[4-piperidin-1-yl-6-(6-prop-2-enoxypyridazin-3-yl)oxy-1,3,5-triazin-2-yl]morpholine (PubChem CID 27396221) has the molecular formula C19H25N7O3 and a molecular weight of 399.46 g/mol. Its IUPAC name is 4-[4-piperidin-1-yl-6-(6-prop-2-enoxypyridazin-3-yl)oxy-1,3,5-triazin-2-yl]morpholine.
| Compound Name | 4-[4-piperidin-1-yl-6-(6-prop-2-enoxypyridazin-3-yl)oxy-1,3,5-triazin-2-yl]morpholine |
|---|---|
| PubChem CID | 27396221 |
| Molecular Formula | C19H25N7O3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[4-piperidin-1-yl-6-(6-prop-2-enoxypyridazin-3-yl)oxy-1,3,5-triazin-2-yl]morpholine |
| SMILES | C=CCOc1ccc(Oc2nc(N3CCCCC3)nc(N3CCOCC3)n2)nn1 |
| InChI | InChI=1S/C19H25N7O3/c1-2-12-28-15-6-7-16(24-23-15)29-19-21-17(25-8-4-3-5-9-25)20-18(22-19)26-10-13-27-14-11-26/h2,6-7H,1,3-5,8-14H2 |
| InChIKey | AQXPURKZCAVODV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|