C26H27N7O4 — CID 23607077
N-(4-methylphenyl)-4-morpholin-4-yl-6-[6-(2-phenoxyethoxy)pyridazin-3-yl]oxy-1,3,5-triazin-2-amine (PubChem CID 23607077) has the molecular formula C26H27N7O4 and a molecular weight of 501.55 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-morpholin-4-yl-6-[6-(2-phenoxyethoxy)pyridazin-3-yl]oxy-1,3,5-triazin-2-amine.
| Compound Name | N-(4-methylphenyl)-4-morpholin-4-yl-6-[6-(2-phenoxyethoxy)pyridazin-3-yl]oxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23607077 |
| Molecular Formula | C26H27N7O4 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-(4-methylphenyl)-4-morpholin-4-yl-6-[6-(2-phenoxyethoxy)pyridazin-3-yl]oxy-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(Nc2nc(Oc3ccc(OCCOc4ccccc4)nn3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C26H27N7O4/c1-19-7-9-20(10-8-19)27-24-28-25(33-13-15-34-16-14-33)30-26(29-24)37-23-12-11-22(31-32-23)36-18-17-35-21-5-3-2-4-6-21/h2-12H,13-18H2,1H3,(H,27,28,29,30) |
| InChIKey | HQJJIEQKJJGHAD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|