C11H18N6O — CID 80930831
[4-[(E)-but-2-enoxy]-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80930831) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is [4-[(E)-but-2-enoxy]-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-[(E)-but-2-enoxy]-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80930831 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [4-[(E)-but-2-enoxy]-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | C/C=C/COc1nc(NN)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C11H18N6O/c1-2-3-8-18-11-14-9(16-12)13-10(15-11)17-6-4-5-7-17/h2-3H,4-8,12H2,1H3,(H,13,14,15,16)/b3-2+ |
| InChIKey | HIYZTDFHBLFMIZ-NSCUHMNNSA-N |
| XLogP | 0.71 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|