C12H22N6O2 — CID 103491759
[4-(1-ethoxypropan-2-yloxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 103491759) has the molecular formula C12H22N6O2 and a molecular weight of 282.35 g/mol. Its IUPAC name is [4-(1-ethoxypropan-2-yloxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(1-ethoxypropan-2-yloxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103491759 |
| Molecular Formula | C12H22N6O2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [4-(1-ethoxypropan-2-yloxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCOCC(C)Oc1nc(NN)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C12H22N6O2/c1-3-19-8-9(2)20-12-15-10(17-13)14-11(16-12)18-6-4-5-7-18/h9H,3-8,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | NGUNOTQDIQFKNQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|