C10H19N7O — CID 80917805
(4-piperazin-1-yl-6-propan-2-yloxy-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80917805) has the molecular formula C10H19N7O and a molecular weight of 253.31 g/mol. Its IUPAC name is (4-piperazin-1-yl-6-propan-2-yloxy-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-piperazin-1-yl-6-propan-2-yloxy-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80917805 |
| Molecular Formula | C10H19N7O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (4-piperazin-1-yl-6-propan-2-yloxy-1,3,5-triazin-2-yl)hydrazine |
| SMILES | CC(C)Oc1nc(NN)nc(N2CCNCC2)n1 |
| InChI | InChI=1S/C10H19N7O/c1-7(2)18-10-14-8(16-11)13-9(15-10)17-5-3-12-4-6-17/h7,12H,3-6,11H2,1-2H3,(H,13,14,15,16) |
| InChIKey | DPMVRGJUIBNYOY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|