C12H20N6O — CID 80904737
[4-(2-azabicyclo[2.2.1]heptan-2-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80904737) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is [4-(2-azabicyclo[2.2.1]heptan-2-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(2-azabicyclo[2.2.1]heptan-2-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80904737 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [4-(2-azabicyclo[2.2.1]heptan-2-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC(C)Oc1nc(NN)nc(N2CC3CCC2C3)n1 |
| InChI | InChI=1S/C12H20N6O/c1-7(2)19-12-15-10(17-13)14-11(16-12)18-6-8-3-4-9(18)5-8/h7-9H,3-6,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | XRWCBZVUJUVIPN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|