C13H15IN6O — CID 80910841
[4-(4-iodophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80910841) has the molecular formula C13H15IN6O and a molecular weight of 398.21 g/mol. Its IUPAC name is [4-(4-iodophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4-iodophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80910841 |
| Molecular Formula | C13H15IN6O |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | [4-(4-iodophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(Oc2ccc(I)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H15IN6O/c14-9-3-5-10(6-4-9)21-13-17-11(19-15)16-12(18-13)20-7-1-2-8-20/h3-6H,1-2,7-8,15H2,(H,16,17,18,19) |
| InChIKey | JXHRPAYUOGFDOA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|