C18H18F6IN5O — CID 3482932
4-(azepan-1-yl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-iodophenyl)-1,3,5-triazin-2-amine (PubChem CID 3482932) has the molecular formula C18H18F6IN5O and a molecular weight of 561.27 g/mol. Its IUPAC name is 4-(azepan-1-yl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-iodophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(azepan-1-yl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-iodophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3482932 |
| Molecular Formula | C18H18F6IN5O |
| Molecular Weight | 561.27 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | 4-(azepan-1-yl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-iodophenyl)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)C(Oc1nc(Nc2ccc(I)cc2)nc(N2CCCCCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C18H18F6IN5O/c19-17(20,21)13(18(22,23)24)31-16-28-14(26-12-7-5-11(25)6-8-12)27-15(29-16)30-9-3-1-2-4-10-30/h5-8,13H,1-4,9-10H2,(H,26,27,28,29) |
| InChIKey | NIJQPHQCODUROE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.27 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|