C14H25N7 — CID 80905338
[4-(4,4-dimethylpiperidin-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80905338) has the molecular formula C14H25N7 and a molecular weight of 291.40 g/mol. Its IUPAC name is [4-(4,4-dimethylpiperidin-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4,4-dimethylpiperidin-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80905338 |
| Molecular Formula | C14H25N7 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | [4-(4,4-dimethylpiperidin-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC1(C)CCN(c2nc(NN)nc(N3CCCC3)n2)CC1 |
| InChI | InChI=1S/C14H25N7/c1-14(2)5-9-21(10-6-14)13-17-11(19-15)16-12(18-13)20-7-3-4-8-20/h3-10,15H2,1-2H3,(H,16,17,18,19) |
| InChIKey | OHXPLGNNSVWQCO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|