C13H23N7O — CID 80929061
4-hydrazinyl-N-[(2-methyloxolan-2-yl)methyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80929061) has the molecular formula C13H23N7O and a molecular weight of 293.38 g/mol. Its IUPAC name is 4-hydrazinyl-N-[(2-methyloxolan-2-yl)methyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-[(2-methyloxolan-2-yl)methyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80929061 |
| Molecular Formula | C13H23N7O |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 4-hydrazinyl-N-[(2-methyloxolan-2-yl)methyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CC1(CNc2nc(NN)nc(N3CCCC3)n2)CCCO1 |
| InChI | InChI=1S/C13H23N7O/c1-13(5-4-8-21-13)9-15-10-16-11(19-14)18-12(17-10)20-6-2-3-7-20/h2-9,14H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | FTTDCRVFZWWLTL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|