C9H16N6S — CID 80925076
(4-ethylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80925076) has the molecular formula C9H16N6S and a molecular weight of 240.34 g/mol. Its IUPAC name is (4-ethylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-ethylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80925076 |
| Molecular Formula | C9H16N6S |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (4-ethylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine |
| SMILES | CCSc1nc(NN)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C9H16N6S/c1-2-16-9-12-7(14-10)11-8(13-9)15-5-3-4-6-15/h2-6,10H2,1H3,(H,11,12,13,14) |
| InChIKey | AUXFGNUUWURSQB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|