C13H22N6S — CID 80923900
(4-cyclohexylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80923900) has the molecular formula C13H22N6S and a molecular weight of 294.43 g/mol. Its IUPAC name is (4-cyclohexylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-cyclohexylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80923900 |
| Molecular Formula | C13H22N6S |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (4-cyclohexylsulfanyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazine |
| SMILES | NNc1nc(SC2CCCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H22N6S/c14-18-11-15-12(19-8-4-5-9-19)17-13(16-11)20-10-6-2-1-3-7-10/h10H,1-9,14H2,(H,15,16,17,18) |
| InChIKey | VVTQHOKCAPWSKL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|