C12H16N8S — CID 80928949
(4-piperidin-1-yl-6-pyrimidin-4-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80928949) has the molecular formula C12H16N8S and a molecular weight of 304.38 g/mol. Its IUPAC name is (4-piperidin-1-yl-6-pyrimidin-4-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-piperidin-1-yl-6-pyrimidin-4-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80928949 |
| Molecular Formula | C12H16N8S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (4-piperidin-1-yl-6-pyrimidin-4-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
| SMILES | NNc1nc(Sc2ccncn2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H16N8S/c13-19-10-16-11(20-6-2-1-3-7-20)18-12(17-10)21-9-4-5-14-8-15-9/h4-5,8H,1-3,6-7,13H2,(H,16,17,18,19) |
| InChIKey | AXTOIZROZMOLFM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|