C12H15N7OS — CID 80920561
(4-morpholin-4-yl-6-pyridin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80920561) has the molecular formula C12H15N7OS and a molecular weight of 305.37 g/mol. Its IUPAC name is (4-morpholin-4-yl-6-pyridin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-morpholin-4-yl-6-pyridin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80920561 |
| Molecular Formula | C12H15N7OS |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (4-morpholin-4-yl-6-pyridin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
| SMILES | NNc1nc(Sc2ccccn2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H15N7OS/c13-18-10-15-11(19-5-7-20-8-6-19)17-12(16-10)21-9-3-1-2-4-14-9/h1-4H,5-8,13H2,(H,15,16,17,18) |
| InChIKey | RVROIGSABMVPMK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|