C16H20N6S — CID 146082608
2-pyridin-2-ylsulfanyl-4,6-dipyrrolidin-1-yl-1,3,5-triazine (PubChem CID 146082608) has the molecular formula C16H20N6S and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfanyl-4,6-dipyrrolidin-1-yl-1,3,5-triazine.
| Compound Name | 2-pyridin-2-ylsulfanyl-4,6-dipyrrolidin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 146082608 |
| Molecular Formula | C16H20N6S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-pyridin-2-ylsulfanyl-4,6-dipyrrolidin-1-yl-1,3,5-triazine |
| SMILES | c1ccc(Sc2nc(N3CCCC3)nc(N3CCCC3)n2)nc1 |
| InChI | InChI=1S/C16H20N6S/c1-2-8-17-13(7-1)23-16-19-14(21-9-3-4-10-21)18-15(20-16)22-11-5-6-12-22/h1-2,7-8H,3-6,9-12H2 |
| InChIKey | OIMDSYJAOLLJMS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |