C14H16ClN5S — CID 80873072
4-(4-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80873072) has the molecular formula C14H16ClN5S and a molecular weight of 321.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80873072 |
| Molecular Formula | C14H16ClN5S |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Sc2ccc(Cl)cc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H16ClN5S/c15-10-4-6-11(7-5-10)21-14-18-12(16)17-13(19-14)20-8-2-1-3-9-20/h4-7H,1-3,8-9H2,(H2,16,17,18,19) |
| InChIKey | QWOWRTMNBIUEPU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |