C14H23N5S — CID 80886210
4-cyclohexylsulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80886210) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is 4-cyclohexylsulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclohexylsulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80886210 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 4-cyclohexylsulfanyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(SC2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H23N5S/c15-12-16-13(19-9-5-2-6-10-19)18-14(17-12)20-11-7-3-1-4-8-11/h11H,1-10H2,(H2,15,16,17,18) |
| InChIKey | HMMBQZZYNUQLRF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |