C18H26N8 — CID 58865864
1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-pyridin-2-ylhydrazine (PubChem CID 58865864) has the molecular formula C18H26N8 and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-pyridin-2-ylhydrazine.
| Compound Name | 1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-pyridin-2-ylhydrazine |
|---|---|
| PubChem CID | 58865864 |
| Molecular Formula | C18H26N8 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-pyridin-2-ylhydrazine |
| SMILES | c1ccc(NNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)nc1 |
| InChI | InChI=1S/C18H26N8/c1-5-11-25(12-6-1)17-20-16(24-23-15-9-3-4-10-19-15)21-18(22-17)26-13-7-2-8-14-26/h3-4,9-10H,1-2,5-8,11-14H2,(H,19,23)(H,20,21,22,24) |
| InChIKey | HNPJHMNMWLOKAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|