C17H29N9 — CID 58865278
1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine (PubChem CID 58865278) has the molecular formula C17H29N9 and a molecular weight of 359.48 g/mol. Its IUPAC name is 1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine.
| Compound Name | 1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 58865278 |
| Molecular Formula | C17H29N9 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 1-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine |
| SMILES | C1CCN(c2nc(NNC3=NCCCN3)nc(N3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C17H29N9/c1-3-10-25(11-4-1)16-20-15(24-23-14-18-8-7-9-19-14)21-17(22-16)26-12-5-2-6-13-26/h1-13H2,(H2,18,19,23)(H,20,21,22,24) |
| InChIKey | NFAHXVVXKALTKH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|