C19H29N9 — CID 58865336
1-(2,6-dimethylpyrimidin-4-yl)-2-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 58865336) has the molecular formula C19H29N9 and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-(2,6-dimethylpyrimidin-4-yl)-2-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | 1-(2,6-dimethylpyrimidin-4-yl)-2-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 58865336 |
| Molecular Formula | C19H29N9 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 1-(2,6-dimethylpyrimidin-4-yl)-2-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | Cc1cc(NNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)nc(C)n1 |
| InChI | InChI=1S/C19H29N9/c1-14-13-16(21-15(2)20-14)25-26-17-22-18(27-9-5-3-6-10-27)24-19(23-17)28-11-7-4-8-12-28/h13H,3-12H2,1-2H3,(H,20,21,25)(H,22,23,24,26) |
| InChIKey | MTQPQGOJHZFKFZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|