C18H30N12 — CID 58949232
(3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-pyridin-2-ylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 58949232) has the molecular formula C18H30N12 and a molecular weight of 414.52 g/mol. Its IUPAC name is (3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-pyridin-2-ylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-pyridin-2-ylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 58949232 |
| Molecular Formula | C18H30N12 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-pyridin-2-ylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(NNc3ccccn3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C18H30N12/c19-11-5-12(20)8-29(7-11)17-24-16(28-27-15-3-1-2-4-23-15)25-18(26-17)30-9-13(21)6-14(22)10-30/h1-4,11-14H,5-10,19-22H2,(H,23,27)(H,24,25,26,28)/t11-,12+,13-,14+ |
| InChIKey | JGQZAGXMDIPYIL-KPWCQOOUSA-N |
| XLogP | -1.57 |
| TPSA | 186.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|