C19H31N11O2S — CID 21104239
N'-[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]benzenesulfonohydrazide (PubChem CID 21104239) has the molecular formula C19H31N11O2S and a molecular weight of 477.60 g/mol. Its IUPAC name is N'-[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]benzenesulfonohydrazide.
| Compound Name | N'-[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 21104239 |
| Molecular Formula | C19H31N11O2S |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N'-[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]benzenesulfonohydrazide |
| SMILES | NC1CC(N)CN(c2nc(NNS(=O)(=O)c3ccccc3)nc(N3CC(N)CC(N)C3)n2)C1 |
| InChI | InChI=1S/C19H31N11O2S/c20-12-6-13(21)9-29(8-12)18-24-17(27-28-33(31,32)16-4-2-1-3-5-16)25-19(26-18)30-10-14(22)7-15(23)11-30/h1-5,12-15,28H,6-11,20-23H2,(H,24,25,26,27) |
| InChIKey | OCTPVQWWBYSRNK-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 207.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|