C19H29F2N11 — CID 21104130
1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(2,5-difluorophenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 21104130) has the molecular formula C19H29F2N11 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(2,5-difluorophenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(2,5-difluorophenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 21104130 |
| Molecular Formula | C19H29F2N11 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(2,5-difluorophenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | NC1CC(N)CN(c2nc(NNc3cc(F)ccc3F)nc(N3CC(N)CC(N)C3)n2)C1 |
| InChI | InChI=1S/C19H29F2N11/c20-10-1-2-15(21)16(3-10)29-30-17-26-18(31-6-11(22)4-12(23)7-31)28-19(27-17)32-8-13(24)5-14(25)9-32/h1-3,11-14,29H,4-9,22-25H2,(H,26,27,28,30) |
| InChIKey | XMEAHCGZZOLWKL-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|