C16H33N11 — CID 58865845
(3R,5S)-1-[4-(3-aminopropylamino)-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 58865845) has the molecular formula C16H33N11 and a molecular weight of 379.52 g/mol. Its IUPAC name is (3R,5S)-1-[4-(3-aminopropylamino)-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-[4-(3-aminopropylamino)-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 58865845 |
| Molecular Formula | C16H33N11 |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | (3R,5S)-1-[4-(3-aminopropylamino)-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | NCCCNc1nc(N2C[C@H](N)C[C@H](N)C2)nc(N2C[C@H](N)C[C@H](N)C2)n1 |
| InChI | InChI=1S/C16H33N11/c17-2-1-3-22-14-23-15(26-6-10(18)4-11(19)7-26)25-16(24-14)27-8-12(20)5-13(21)9-27/h10-13H,1-9,17-21H2,(H,22,23,24,25)/t10-,11+,12-,13+ |
| InChIKey | MIMQHJSPKWINPS-MPZDIEGVSA-N |
| XLogP | -2.64 |
| TPSA | 187.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|