C23H42N10 — CID 158234877
(3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 158234877) has the molecular formula C23H42N10 and a molecular weight of 458.66 g/mol. Its IUPAC name is (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 158234877 |
| Molecular Formula | C23H42N10 |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | CC1(C)[C@H]2CC[C@H](CNc3nc(N4C[C@H](N)C[C@H](N)C4)nc(N4C[C@H](N)C[C@H](N)C4)n3)[C@@H]1C2 |
| InChI | InChI=1S/C23H42N10/c1-23(2)14-4-3-13(19(23)5-14)8-28-20-29-21(32-9-15(24)6-16(25)10-32)31-22(30-20)33-11-17(26)7-18(27)12-33/h13-19H,3-12,24-27H2,1-2H3,(H,28,29,30,31)/t13-,14+,15-,16+,17-,18+,19+/m1/s1 |
| InChIKey | GEVKWQCEJFHEFG-LUMDGCDRSA-N |
| XLogP | 0.09 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |