C34H46N8O — CID 44534177
2-[[4-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-naphthalen-2-ylacetamide (PubChem CID 44534177) has the molecular formula C34H46N8O and a molecular weight of 582.80 g/mol. Its IUPAC name is 2-[[4-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[[4-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 44534177 |
| Molecular Formula | C34H46N8O |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | 2-[[4-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-naphthalen-2-ylacetamide |
| SMILES | CC1(C)[C@H]2CC[C@@H](CNc3nc(NCC(=O)Nc4ccc5ccccc5c4)nc(N4CCC(N5CCCC5)CC4)n3)[C@@H]1C2 |
| InChI | InChI=1S/C34H46N8O/c1-34(2)26-11-9-25(29(34)20-26)21-35-31-38-32(36-22-30(43)37-27-12-10-23-7-3-4-8-24(23)19-27)40-33(39-31)42-17-13-28(14-18-42)41-15-5-6-16-41/h3-4,7-8,10,12,19,25-26,28-29H,5-6,9,11,13-18,20-22H2,1-2H3,(H,37,43)(H2,35,36,38,39,40)/t25-,26-,29-/m0/s1 |
| InChIKey | UNDGXHIXXWQLET-ZEZDXWPOSA-N |
| XLogP | 5.62 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |