C28H35N5O2S — CID 87909169
N-[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-6-yl]-3-[4-(sulfanylmethoxy)phenyl]propanamide (PubChem CID 87909169) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is N-[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-6-yl]-3-[4-(sulfanylmethoxy)phenyl]propanamide.
| Compound Name | N-[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-6-yl]-3-[4-(sulfanylmethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 87909169 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N-[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-6-yl]-3-[4-(sulfanylmethoxy)phenyl]propanamide |
| SMILES | Cc1nc(N2CCC(N3CCCC3)CC2)nc2ccc(NC(=O)CCc3ccc(OCS)cc3)cc12 |
| InChI | InChI=1S/C28H35N5O2S/c1-20-25-18-22(30-27(34)11-6-21-4-8-24(9-5-21)35-19-36)7-10-26(25)31-28(29-20)33-16-12-23(13-17-33)32-14-2-3-15-32/h4-5,7-10,18,23,36H,2-3,6,11-17,19H2,1H3,(H,30,34) |
| InChIKey | WMYISLSUJSJLBN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|