C21H30N4OS — CID 118758928
4-[1-(6-ethoxy-4-methylquinazolin-2-yl)azepan-4-yl]thiomorpholine (PubChem CID 118758928) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is 4-[1-(6-ethoxy-4-methylquinazolin-2-yl)azepan-4-yl]thiomorpholine.
| Compound Name | 4-[1-(6-ethoxy-4-methylquinazolin-2-yl)azepan-4-yl]thiomorpholine |
|---|---|
| PubChem CID | 118758928 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-[1-(6-ethoxy-4-methylquinazolin-2-yl)azepan-4-yl]thiomorpholine |
| SMILES | CCOc1ccc2nc(N3CCCC(N4CCSCC4)CC3)nc(C)c2c1 |
| InChI | InChI=1S/C21H30N4OS/c1-3-26-18-6-7-20-19(15-18)16(2)22-21(23-20)25-9-4-5-17(8-10-25)24-11-13-27-14-12-24/h6-7,15,17H,3-5,8-14H2,1-2H3 |
| InChIKey | IYDUVGJRGQQNHI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |