C22H26N4O2S — CID 42169579
(3S)-1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 42169579) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is (3S)-1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42169579 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (3S)-1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | CCOc1ccc2nc(N3CCC[C@H](C(=O)NCc4cccs4)C3)nc(C)c2c1 |
| InChI | InChI=1S/C22H26N4O2S/c1-3-28-17-8-9-20-19(12-17)15(2)24-22(25-20)26-10-4-6-16(14-26)21(27)23-13-18-7-5-11-29-18/h5,7-9,11-12,16H,3-4,6,10,13-14H2,1-2H3,(H,23,27)/t16-/m0/s1 |
| InChIKey | KSHNVJRFMJOHCO-INIZCTEOSA-N |
| XLogP | 3.93 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |