C22H30N6O — CID 45202558
1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(2-pyrazol-1-ylethyl)azepan-4-amine (PubChem CID 45202558) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(2-pyrazol-1-ylethyl)azepan-4-amine.
| Compound Name | 1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(2-pyrazol-1-ylethyl)azepan-4-amine |
|---|---|
| PubChem CID | 45202558 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(2-pyrazol-1-ylethyl)azepan-4-amine |
| SMILES | CCOc1ccc2nc(N3CCCC(NCCn4cccn4)CC3)nc(C)c2c1 |
| InChI | InChI=1S/C22H30N6O/c1-3-29-19-7-8-21-20(16-19)17(2)25-22(26-21)27-12-4-6-18(9-14-27)23-11-15-28-13-5-10-24-28/h5,7-8,10,13,16,18,23H,3-4,6,9,11-12,14-15H2,1-2H3 |
| InChIKey | KPVITDCXUVRBGT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |