C25H33N5O — CID 45196940
1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(3-pyridin-3-ylpropyl)azepan-4-amine (PubChem CID 45196940) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(3-pyridin-3-ylpropyl)azepan-4-amine.
| Compound Name | 1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(3-pyridin-3-ylpropyl)azepan-4-amine |
|---|---|
| PubChem CID | 45196940 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 1-(6-ethoxy-4-methylquinazolin-2-yl)-N-(3-pyridin-3-ylpropyl)azepan-4-amine |
| SMILES | CCOc1ccc2nc(N3CCCC(NCCCc4cccnc4)CC3)nc(C)c2c1 |
| InChI | InChI=1S/C25H33N5O/c1-3-31-22-10-11-24-23(17-22)19(2)28-25(29-24)30-15-6-9-21(12-16-30)27-14-5-8-20-7-4-13-26-18-20/h4,7,10-11,13,17-18,21,27H,3,5-6,8-9,12,14-16H2,1-2H3 |
| InChIKey | UOCNBYLNGJQCFE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|